C12H22N2 — CID 74060050
5-ethenyldeca-2,8-diene-1,10-diamine (PubChem CID 74060050) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 5-ethenyldeca-2,8-diene-1,10-diamine.
| Compound Name | 5-ethenyldeca-2,8-diene-1,10-diamine |
|---|---|
| PubChem CID | 74060050 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 5-ethenyldeca-2,8-diene-1,10-diamine |
| SMILES | C=CC(CC=CCN)CCC=CCN |
| InChI | InChI=1S/C12H22N2/c1-2-12(9-5-7-11-14)8-4-3-6-10-13/h2-3,5-7,12H,1,4,8-11,13-14H2 |
| InChIKey | QCPRUAKLLLGWNL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|