C16H31N — CID 89062081
(E)-9-ethenyl-N,N-dimethyldodec-5-en-1-amine (PubChem CID 89062081) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is (E)-9-ethenyl-N,N-dimethyldodec-5-en-1-amine.
| Compound Name | (E)-9-ethenyl-N,N-dimethyldodec-5-en-1-amine |
|---|---|
| PubChem CID | 89062081 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | (E)-9-ethenyl-N,N-dimethyldodec-5-en-1-amine |
| SMILES | C=CC(CCC)CC/C=C/CCCCN(C)C |
| InChI | InChI=1S/C16H31N/c1-5-13-16(6-2)14-11-9-7-8-10-12-15-17(3)4/h6-7,9,16H,2,5,8,10-15H2,1,3-4H3/b9-7+ |
| InChIKey | PFRYDAHZAWGWHZ-VQHVLOKHSA-N |
| XLogP | 4.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|