C44H83N — CID 167059151
(4E,13E,18Z)-N,N-dimethyl-6-[(Z)-octadec-9-enyl]tetracosa-4,13,18-trien-1-amine (PubChem CID 167059151) has the molecular formula C44H83N and a molecular weight of 626.16 g/mol. Its IUPAC name is (4E,13E,18Z)-N,N-dimethyl-6-[(Z)-octadec-9-enyl]tetracosa-4,13,18-trien-1-amine.
| Compound Name | (4E,13E,18Z)-N,N-dimethyl-6-[(Z)-octadec-9-enyl]tetracosa-4,13,18-trien-1-amine |
|---|---|
| PubChem CID | 167059151 |
| Molecular Formula | C44H83N |
| Molecular Weight | 626.16 g/mol |
| Exact Mass | 625.65 |
| IUPAC Name | (4E,13E,18Z)-N,N-dimethyl-6-[(Z)-octadec-9-enyl]tetracosa-4,13,18-trien-1-amine |
| SMILES | CCCCC/C=C\CCC/C=C/CCCCCCC(/C=C/CCCN(C)C)CCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C44H83N/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36-40-44(42-38-35-39-43-45(3)4)41-37-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13,15,20,22-23,25,38,42,44H,5-12,14,16-19,21,24,26-37,39-41,43H2,1-4H3/b15-13-,22-20-,25-23+,42-38+ |
| InChIKey | CTLYCWNHDLQZRV-DFGRUJFHSA-N |
| XLogP | 15.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.16 |
| LogP ≤ 5 | 15.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|