C14H23NO2 — CID 23592085
4,5-ditert-butyl-1-methyl-3H-pyridine-2,6-dione (PubChem CID 23592085) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 4,5-ditert-butyl-1-methyl-3H-pyridine-2,6-dione.
| Compound Name | 4,5-ditert-butyl-1-methyl-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 23592085 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 4,5-ditert-butyl-1-methyl-3H-pyridine-2,6-dione |
| SMILES | CN1C(=O)CC(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C14H23NO2/c1-13(2,3)9-8-10(16)15(7)12(17)11(9)14(4,5)6/h8H2,1-7H3 |
| InChIKey | MCPHYKQAUVLHLH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|