C21H18FNO — CID 23593121
N-(3-fluoro-4-methylphenyl)-N,7-dimethyldibenzofuran-3-amine (PubChem CID 23593121) has the molecular formula C21H18FNO and a molecular weight of 319.38 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-N,7-dimethyldibenzofuran-3-amine.
| Compound Name | N-(3-fluoro-4-methylphenyl)-N,7-dimethyldibenzofuran-3-amine |
|---|---|
| PubChem CID | 23593121 |
| Molecular Formula | C21H18FNO |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-N,7-dimethyldibenzofuran-3-amine |
| SMILES | Cc1ccc2c(c1)oc1cc(N(C)c3ccc(C)c(F)c3)ccc12 |
| InChI | InChI=1S/C21H18FNO/c1-13-4-8-17-18-9-7-16(12-21(18)24-20(17)10-13)23(3)15-6-5-14(2)19(22)11-15/h4-12H,1-3H3 |
| InChIKey | YYIXACLFRVGQEH-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |