C20H16FNO — CID 23593175
N-(4-fluorophenyl)-N,7-dimethyldibenzofuran-3-amine (PubChem CID 23593175) has the molecular formula C20H16FNO and a molecular weight of 305.35 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N,7-dimethyldibenzofuran-3-amine.
| Compound Name | N-(4-fluorophenyl)-N,7-dimethyldibenzofuran-3-amine |
|---|---|
| PubChem CID | 23593175 |
| Molecular Formula | C20H16FNO |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-(4-fluorophenyl)-N,7-dimethyldibenzofuran-3-amine |
| SMILES | Cc1ccc2c(c1)oc1cc(N(C)c3ccc(F)cc3)ccc12 |
| InChI | InChI=1S/C20H16FNO/c1-13-3-9-17-18-10-8-16(12-20(18)23-19(17)11-13)22(2)15-6-4-14(21)5-7-15/h3-12H,1-2H3 |
| InChIKey | YZXFCVUPOGKOCO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |