C21H16F3NO — CID 23593255
N,8-dimethyl-N-[4-(trifluoromethyl)phenyl]dibenzofuran-2-amine (PubChem CID 23593255) has the molecular formula C21H16F3NO and a molecular weight of 355.36 g/mol. Its IUPAC name is N,8-dimethyl-N-[4-(trifluoromethyl)phenyl]dibenzofuran-2-amine.
| Compound Name | N,8-dimethyl-N-[4-(trifluoromethyl)phenyl]dibenzofuran-2-amine |
|---|---|
| PubChem CID | 23593255 |
| Molecular Formula | C21H16F3NO |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N,8-dimethyl-N-[4-(trifluoromethyl)phenyl]dibenzofuran-2-amine |
| SMILES | Cc1ccc2oc3ccc(N(C)c4ccc(C(F)(F)F)cc4)cc3c2c1 |
| InChI | InChI=1S/C21H16F3NO/c1-13-3-9-19-17(11-13)18-12-16(8-10-20(18)26-19)25(2)15-6-4-14(5-7-15)21(22,23)24/h3-12H,1-2H3 |
| InChIKey | OSEPQFQIXFSIMR-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |