C29H39BN6O5 — CID 23593892
CID 23593892 (PubChem CID 23593892) has the molecular formula C29H39BN6O5 and a molecular weight of 562.48 g/mol.
| Compound Name | CID 23593892 |
|---|---|
| PubChem CID | 23593892 |
| Molecular Formula | C29H39BN6O5 |
| Molecular Weight | 562.48 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | — |
| SMILES | [B]C(=O)NC(C)(C)C(=O)NC(COCc1ccccc1)C(=O)Nc1cn(C2(C(=O)N3CCC(C)CC3)CCC2)cn1 |
| InChI | InChI=1S/C29H39BN6O5/c1-20-10-14-35(15-11-20)26(39)29(12-7-13-29)36-16-23(31-19-36)33-24(37)22(18-41-17-21-8-5-4-6-9-21)32-25(38)28(2,3)34-27(30)40/h4-6,8-9,16,19-20,22H,7,10-15,17-18H2,1-3H3,(H,32,38)(H,33,37)(H,34,40) |
| InChIKey | VMQLCSRMYHNOFP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|