C25H33BN6O5 — CID 23593893
CID 23593893 (PubChem CID 23593893) has the molecular formula C25H33BN6O5 and a molecular weight of 508.39 g/mol.
| Compound Name | CID 23593893 |
|---|---|
| PubChem CID | 23593893 |
| Molecular Formula | C25H33BN6O5 |
| Molecular Weight | 508.39 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | — |
| SMILES | [B]C(=O)NC(C)(C)C(=O)NC(COCc1ccccc1)C(=O)Nc1cn(CC(=O)N2CCCCC2)cn1 |
| InChI | InChI=1S/C25H33BN6O5/c1-25(2,30-24(26)36)23(35)28-19(16-37-15-18-9-5-3-6-10-18)22(34)29-20-13-31(17-27-20)14-21(33)32-11-7-4-8-12-32/h3,5-6,9-10,13,17,19H,4,7-8,11-12,14-16H2,1-2H3,(H,28,35)(H,29,34)(H,30,36) |
| InChIKey | RIJHOUVKWQYYSK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|