C26H27BF3N5O5 — CID 59103071
CID 59103071 (PubChem CID 59103071) has the molecular formula C26H27BF3N5O5 and a molecular weight of 557.34 g/mol.
| Compound Name | CID 59103071 |
|---|---|
| PubChem CID | 59103071 |
| Molecular Formula | C26H27BF3N5O5 |
| Molecular Weight | 557.34 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | — |
| SMILES | [B]C(=O)NC(C)(C)C(=O)N[C@H](COCc1ccccc1)C(=O)Nc1cn(Cc2ccc(OC(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C26H27BF3N5O5/c1-25(2,34-24(27)38)23(37)32-20(15-39-14-18-6-4-3-5-7-18)22(36)33-21-13-35(16-31-21)12-17-8-10-19(11-9-17)40-26(28,29)30/h3-11,13,16,20H,12,14-15H2,1-2H3,(H,32,37)(H,33,36)(H,34,38)/t20-/m1/s1 |
| InChIKey | BBERSKGQQPRIGR-HXUWFJFHSA-N |
| XLogP | 3.13 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|