C18H34N2O3 — CID 23594696
[4,8-dimethyl-6-[methyl(propan-2-yl)amino]-7-oxonon-1-en-5-yl] 2-(methylamino)acetate (PubChem CID 23594696) has the molecular formula C18H34N2O3 and a molecular weight of 326.48 g/mol. Its IUPAC name is [4,8-dimethyl-6-[methyl(propan-2-yl)amino]-7-oxonon-1-en-5-yl] 2-(methylamino)acetate.
| Compound Name | [4,8-dimethyl-6-[methyl(propan-2-yl)amino]-7-oxonon-1-en-5-yl] 2-(methylamino)acetate |
|---|---|
| PubChem CID | 23594696 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | [4,8-dimethyl-6-[methyl(propan-2-yl)amino]-7-oxonon-1-en-5-yl] 2-(methylamino)acetate |
| SMILES | C=CCC(C)C(OC(=O)CNC)C(C(=O)C(C)C)N(C)C(C)C |
| InChI | InChI=1S/C18H34N2O3/c1-9-10-14(6)18(23-15(21)11-19-7)16(17(22)12(2)3)20(8)13(4)5/h9,12-14,16,18-19H,1,10-11H2,2-8H3 |
| InChIKey | DLTYNDLBGGGEDA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|