C17H28N2O4 — CID 23594734
4-ethyl-3-[2-[(2,2,3-trimethyl-1,3-oxazolidin-4-yl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 23594734) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is 4-ethyl-3-[2-[(2,2,3-trimethyl-1,3-oxazolidin-4-yl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-ethyl-3-[2-[(2,2,3-trimethyl-1,3-oxazolidin-4-yl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 23594734 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 4-ethyl-3-[2-[(2,2,3-trimethyl-1,3-oxazolidin-4-yl)methyl]pent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=CCC(CC1COC(C)(C)N1C)C(=O)N1C(=O)OCC1CC |
| InChI | InChI=1S/C17H28N2O4/c1-6-8-12(9-14-11-23-17(3,4)18(14)5)15(20)19-13(7-2)10-22-16(19)21/h6,12-14H,1,7-11H2,2-5H3 |
| InChIKey | WRSRJHOFZZNVPC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|