C25H21N3O2 — CID 23595994
N-[5-(furan-2-yl)-1H-pyrazol-3-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 23595994) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-[5-(furan-2-yl)-1H-pyrazol-3-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | N-[5-(furan-2-yl)-1H-pyrazol-3-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 23595994 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-[5-(furan-2-yl)-1H-pyrazol-3-yl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | CC1(C(=O)Nc2cc(-c3ccco3)[nH]n2)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C25H21N3O2/c1-25(24(29)26-22-13-20(27-28-22)21-11-6-12-30-21)14-19-15-7-2-4-9-17(15)23(25)18-10-5-3-8-16(18)19/h2-13,19,23H,14H2,1H3,(H2,26,27,28,29) |
| InChIKey | LFHXBKKFTIHURX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |