C26H25NO — CID 1331415
(15S)-N-(3,5-dimethylphenyl)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 1331415) has the molecular formula C26H25NO and a molecular weight of 367.49 g/mol. Its IUPAC name is (15S)-N-(3,5-dimethylphenyl)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | (15S)-N-(3,5-dimethylphenyl)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 1331415 |
| Molecular Formula | C26H25NO |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | (15S)-N-(3,5-dimethylphenyl)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)[C@@]2(C)CC3c4ccccc4C2c2ccccc23)c1 |
| InChI | InChI=1S/C26H25NO/c1-16-12-17(2)14-18(13-16)27-25(28)26(3)15-23-19-8-4-6-10-21(19)24(26)22-11-7-5-9-20(22)23/h4-14,23-24H,15H2,1-3H3,(H,27,28)/t23?,24?,26-/m0/s1 |
| InChIKey | QNXUJPMIKVLWKD-RSMFLLDRSA-N |
| XLogP | 5.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |