C26H26N2O3S — CID 23595980
N-[4-(dimethylsulfamoyl)phenyl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 23595980) has the molecular formula C26H26N2O3S and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[4-(dimethylsulfamoyl)phenyl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | N-[4-(dimethylsulfamoyl)phenyl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 23595980 |
| Molecular Formula | C26H26N2O3S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-[4-(dimethylsulfamoyl)phenyl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC(=O)C2(C)CC3c4ccccc4C2c2ccccc23)cc1 |
| InChI | InChI=1S/C26H26N2O3S/c1-26(25(29)27-17-12-14-18(15-13-17)32(30,31)28(2)3)16-23-19-8-4-6-10-21(19)24(26)22-11-7-5-9-20(22)23/h4-15,23-24H,16H2,1-3H3,(H,27,29) |
| InChIKey | NIUPLQOMNVJFGN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |