C29H27N3O4S — CID 23596325
N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 23596325) has the molecular formula C29H27N3O4S and a molecular weight of 513.62 g/mol. Its IUPAC name is N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 23596325 |
| Molecular Formula | C29H27N3O4S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(NC(=O)C3(C)CC4c5ccccc5C3c3ccccc34)cc2)c1C |
| InChI | InChI=1S/C29H27N3O4S/c1-17-18(2)31-36-27(17)32-37(34,35)20-14-12-19(13-15-20)30-28(33)29(3)16-25-21-8-4-6-10-23(21)26(29)24-11-7-5-9-22(24)25/h4-15,25-26,32H,16H2,1-3H3,(H,30,33) |
| InChIKey | KKXVAJRIYHXIML-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |