About (2-oxooxolan-3-yl) 12-hydroxydodecanoate
(2-oxooxolan-3-yl) 12-hydroxydodecanoate (PubChem CID 23597889) has the molecular formula C16H28O5
and a molecular weight of 300.40 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 12-hydroxydodecanoate.
Molecular Properties
| Compound Name | (2-oxooxolan-3-yl) 12-hydroxydodecanoate |
| PubChem CID | 23597889 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (2-oxooxolan-3-yl) 12-hydroxydodecanoate |
| SMILES | O=C(CCCCCCCCCCCO)OC1CCOC1=O |
| InChI | InChI=1S/C16H28O5/c17-12-9-7-5-3-1-2-4-6-8-10-15(18)21-14-11-13-20-16(14)19/h14,17H,1-13H2 |
| InChIKey | OSVMOKKHIYVFND-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-oxooxolan-3-yl) 12-hydroxydodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxooxolan-3-yl) 12-hydroxydodecanoate?
The IUPAC name of (2-oxooxolan-3-yl) 12-hydroxydodecanoate (CID 23597889) is (2-oxooxolan-3-yl) 12-hydroxydodecanoate.
What is the SMILES notation for (2-oxooxolan-3-yl) 12-hydroxydodecanoate?
The canonical SMILES for (2-oxooxolan-3-yl) 12-hydroxydodecanoate is O=C(CCCCCCCCCCCO)OC1CCOC1=O.
What is the InChIKey of (2-oxooxolan-3-yl) 12-hydroxydodecanoate?
The InChIKey is OSVMOKKHIYVFND-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O5/c17-12-9-7-5-3-1-2-4-6-8-10-15(18)21-14-11-13-20-16(14)19/h14,17H,1-13H2.
What are the key properties of (2-oxooxolan-3-yl) 12-hydroxydodecanoate?
(2-oxooxolan-3-yl) 12-hydroxydodecanoate has a molecular weight of 300.40 g/mol, XLogP of 2.74, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxooxolan-3-yl) 12-hydroxydodecanoate is sourced from PubChem (CID 23597889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).