About Stearoyllactic acid
Stearoyllactic acid (PubChem CID 86677) has the molecular formula C21H40O4
and a molecular weight of 356.50 g/mol. Its IUPAC name is 2-octadecanoyloxypropanoic acid.
Molecular Properties
| Compound Name | Stearoyllactic acid |
| PubChem CID | 86677 |
| Molecular Formula | C21H40O4 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | 2-octadecanoyloxypropanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OC(C)C(=O)O |
| InChI | InChI=1S/C21H40O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(22)25-19(2)21(23)24/h19H,3-18H2,1-2H3,(H,23,24) |
| InChIKey | QMGGUIASDZZMHS-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | 328 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze Stearoyllactic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Stearoyllactic acid?
The IUPAC name of Stearoyllactic acid (CID 86677) is 2-octadecanoyloxypropanoic acid.
What is the SMILES notation for Stearoyllactic acid?
The canonical SMILES for Stearoyllactic acid is CCCCCCCCCCCCCCCCCC(=O)OC(C)C(=O)O.
What is the InChIKey of Stearoyllactic acid?
The InChIKey is QMGGUIASDZZMHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(22)25-19(2)21(23)24/h19H,3-18H2,1-2H3,(H,23,24).
What are the key properties of Stearoyllactic acid?
Stearoyllactic acid has a molecular weight of 356.50 g/mol, XLogP of 8.50, 19 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Stearoyllactic acid is sourced from PubChem (CID 86677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).