C24H28N2O4S2 — CID 23602511
N-[3-[butan-2-yl(furan-2-ylmethyl)amino]propyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide (PubChem CID 23602511) has the molecular formula C24H28N2O4S2 and a molecular weight of 472.63 g/mol. Its IUPAC name is N-[3-[butan-2-yl(furan-2-ylmethyl)amino]propyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide.
| Compound Name | N-[3-[butan-2-yl(furan-2-ylmethyl)amino]propyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide |
|---|---|
| PubChem CID | 23602511 |
| Molecular Formula | C24H28N2O4S2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | N-[3-[butan-2-yl(furan-2-ylmethyl)amino]propyl]-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide |
| SMILES | CCC(C)N(CCCNC(=O)c1cc2c(s1)-c1ccccc1S(=O)(=O)C2)Cc1ccco1 |
| InChI | InChI=1S/C24H28N2O4S2/c1-3-17(2)26(15-19-8-6-13-30-19)12-7-11-25-24(27)21-14-18-16-32(28,29)22-10-5-4-9-20(22)23(18)31-21/h4-6,8-10,13-14,17H,3,7,11-12,15-16H2,1-2H3,(H,25,27) |
| InChIKey | SDLIWNZUBIUZJJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|