C22H23NO5S2 — CID 23602503
N-(3-ethoxypropyl)-N-(furan-2-ylmethyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide (PubChem CID 23602503) has the molecular formula C22H23NO5S2 and a molecular weight of 445.56 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-N-(furan-2-ylmethyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-N-(furan-2-ylmethyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide |
|---|---|
| PubChem CID | 23602503 |
| Molecular Formula | C22H23NO5S2 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-(3-ethoxypropyl)-N-(furan-2-ylmethyl)-5,5-dioxo-4H-thieno[3,2-c]thiochromene-2-carboxamide |
| SMILES | CCOCCCN(Cc1ccco1)C(=O)c1cc2c(s1)-c1ccccc1S(=O)(=O)C2 |
| InChI | InChI=1S/C22H23NO5S2/c1-2-27-11-6-10-23(14-17-7-5-12-28-17)22(24)19-13-16-15-30(25,26)20-9-4-3-8-18(20)21(16)29-19/h3-5,7-9,12-13H,2,6,10-11,14-15H2,1H3 |
| InChIKey | JDEAWANWPBKZRX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|