C23H23ClN2O3S — CID 46257034
4-chloro-N-(3-ethoxypropyl)-N-(furan-2-ylmethyl)-8-methylthieno[3,2-c]quinoline-2-carboxamide (PubChem CID 46257034) has the molecular formula C23H23ClN2O3S and a molecular weight of 442.97 g/mol. Its IUPAC name is 4-chloro-N-(3-ethoxypropyl)-N-(furan-2-ylmethyl)-8-methylthieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | 4-chloro-N-(3-ethoxypropyl)-N-(furan-2-ylmethyl)-8-methylthieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 46257034 |
| Molecular Formula | C23H23ClN2O3S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 4-chloro-N-(3-ethoxypropyl)-N-(furan-2-ylmethyl)-8-methylthieno[3,2-c]quinoline-2-carboxamide |
| SMILES | CCOCCCN(Cc1ccco1)C(=O)c1cc2c(Cl)nc3ccc(C)cc3c2s1 |
| InChI | InChI=1S/C23H23ClN2O3S/c1-3-28-10-5-9-26(14-16-6-4-11-29-16)23(27)20-13-18-21(30-20)17-12-15(2)7-8-19(17)25-22(18)24/h4,6-8,11-13H,3,5,9-10,14H2,1-2H3 |
| InChIKey | UMJXQQMELZDIEN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|