About N-benzyl-4-chloro-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide
N-benzyl-4-chloro-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide (PubChem CID 46256894) has the molecular formula C21H17ClN2OS
and a molecular weight of 380.90 g/mol. Its IUPAC name is N-benzyl-4-chloro-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide.
Molecular Properties
| Compound Name | N-benzyl-4-chloro-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide |
| PubChem CID | 46256894 |
| Molecular Formula | C21H17ClN2OS |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N-benzyl-4-chloro-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide |
| SMILES | Cc1ccc2nc(Cl)c3cc(C(=O)N(C)Cc4ccccc4)sc3c2c1 |
| InChI | InChI=1S/C21H17ClN2OS/c1-13-8-9-17-15(10-13)19-16(20(22)23-17)11-18(26-19)21(25)24(2)12-14-6-4-3-5-7-14/h3-11H,12H2,1-2H3 |
| InChIKey | KQJITRUHMLESMI-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-4-chloro-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-chloro-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide?
The IUPAC name of N-benzyl-4-chloro-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide (CID 46256894) is N-benzyl-4-chloro-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide.
What is the SMILES notation for N-benzyl-4-chloro-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide?
The canonical SMILES for N-benzyl-4-chloro-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide is Cc1ccc2nc(Cl)c3cc(C(=O)N(C)Cc4ccccc4)sc3c2c1.
What is the InChIKey of N-benzyl-4-chloro-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide?
The InChIKey is KQJITRUHMLESMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17ClN2OS/c1-13-8-9-17-15(10-13)19-16(20(22)23-17)11-18(26-19)21(25)24(2)12-14-6-4-3-5-7-14/h3-11H,12H2,1-2H3.
What are the key properties of N-benzyl-4-chloro-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide?
N-benzyl-4-chloro-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide has a molecular weight of 380.90 g/mol, XLogP of 5.68, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-chloro-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide is sourced from PubChem (CID 46256894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).