C21H17ClN2OS — CID 46256090
4-chloro-N-ethyl-N-(3-methylphenyl)thieno[3,2-c]quinoline-2-carboxamide (PubChem CID 46256090) has the molecular formula C21H17ClN2OS and a molecular weight of 380.90 g/mol. Its IUPAC name is 4-chloro-N-ethyl-N-(3-methylphenyl)thieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | 4-chloro-N-ethyl-N-(3-methylphenyl)thieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 46256090 |
| Molecular Formula | C21H17ClN2OS |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 4-chloro-N-ethyl-N-(3-methylphenyl)thieno[3,2-c]quinoline-2-carboxamide |
| SMILES | CCN(C(=O)c1cc2c(Cl)nc3ccccc3c2s1)c1cccc(C)c1 |
| InChI | InChI=1S/C21H17ClN2OS/c1-3-24(14-8-6-7-13(2)11-14)21(25)18-12-16-19(26-18)15-9-4-5-10-17(15)23-20(16)22/h4-12H,3H2,1-2H3 |
| InChIKey | DHAZLOWYCZHFPD-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|