C25H25ClN2OS — CID 46256980
4-chloro-8-methyl-N-(4-propan-2-ylphenyl)-N-propylthieno[3,2-c]quinoline-2-carboxamide (PubChem CID 46256980) has the molecular formula C25H25ClN2OS and a molecular weight of 437.01 g/mol. Its IUPAC name is 4-chloro-8-methyl-N-(4-propan-2-ylphenyl)-N-propylthieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | 4-chloro-8-methyl-N-(4-propan-2-ylphenyl)-N-propylthieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 46256980 |
| Molecular Formula | C25H25ClN2OS |
| Molecular Weight | 437.01 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 4-chloro-8-methyl-N-(4-propan-2-ylphenyl)-N-propylthieno[3,2-c]quinoline-2-carboxamide |
| SMILES | CCCN(C(=O)c1cc2c(Cl)nc3ccc(C)cc3c2s1)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C25H25ClN2OS/c1-5-12-28(18-9-7-17(8-10-18)15(2)3)25(29)22-14-20-23(30-22)19-13-16(4)6-11-21(19)27-24(20)26/h6-11,13-15H,5,12H2,1-4H3 |
| InChIKey | GVJPOUXATACHAT-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.01 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|