C23H29ClN4OS — CID 44522092
4-chloro-8-methyl-N-[3-(4-propylpiperazin-1-yl)propyl]thieno[3,2-c]quinoline-2-carboxamide (PubChem CID 44522092) has the molecular formula C23H29ClN4OS and a molecular weight of 445.03 g/mol. Its IUPAC name is 4-chloro-8-methyl-N-[3-(4-propylpiperazin-1-yl)propyl]thieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | 4-chloro-8-methyl-N-[3-(4-propylpiperazin-1-yl)propyl]thieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 44522092 |
| Molecular Formula | C23H29ClN4OS |
| Molecular Weight | 445.03 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 4-chloro-8-methyl-N-[3-(4-propylpiperazin-1-yl)propyl]thieno[3,2-c]quinoline-2-carboxamide |
| SMILES | CCCN1CCN(CCCNC(=O)c2cc3c(Cl)nc4ccc(C)cc4c3s2)CC1 |
| InChI | InChI=1S/C23H29ClN4OS/c1-3-8-27-10-12-28(13-11-27)9-4-7-25-23(29)20-15-18-21(30-20)17-14-16(2)5-6-19(17)26-22(18)24/h5-6,14-15H,3-4,7-13H2,1-2H3,(H,25,29) |
| InChIKey | YXEOHYMDZCEFCF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.03 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|