C22H21ClN2O2S — CID 46257036
N-butyl-4-chloro-N-(furan-2-ylmethyl)-8-methylthieno[3,2-c]quinoline-2-carboxamide (PubChem CID 46257036) has the molecular formula C22H21ClN2O2S and a molecular weight of 412.94 g/mol. Its IUPAC name is N-butyl-4-chloro-N-(furan-2-ylmethyl)-8-methylthieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | N-butyl-4-chloro-N-(furan-2-ylmethyl)-8-methylthieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 46257036 |
| Molecular Formula | C22H21ClN2O2S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N-butyl-4-chloro-N-(furan-2-ylmethyl)-8-methylthieno[3,2-c]quinoline-2-carboxamide |
| SMILES | CCCCN(Cc1ccco1)C(=O)c1cc2c(Cl)nc3ccc(C)cc3c2s1 |
| InChI | InChI=1S/C22H21ClN2O2S/c1-3-4-9-25(13-15-6-5-10-27-15)22(26)19-12-17-20(28-19)16-11-14(2)7-8-18(16)24-21(17)23/h5-8,10-12H,3-4,9,13H2,1-2H3 |
| InChIKey | QKRHAPLNPYINAG-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|