C21H14N4S — CID 23606775
4-pyridin-4-yl-2-thiophen-2-yl-5H-benzo[g][1,3,5]benzotriazepine (PubChem CID 23606775) has the molecular formula C21H14N4S and a molecular weight of 354.44 g/mol. Its IUPAC name is 4-pyridin-4-yl-2-thiophen-2-yl-5H-benzo[g][1,3,5]benzotriazepine.
| Compound Name | 4-pyridin-4-yl-2-thiophen-2-yl-5H-benzo[g][1,3,5]benzotriazepine |
|---|---|
| PubChem CID | 23606775 |
| Molecular Formula | C21H14N4S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 4-pyridin-4-yl-2-thiophen-2-yl-5H-benzo[g][1,3,5]benzotriazepine |
| SMILES | c1csc(C2=Nc3c(ccc4ccccc34)NC(c3ccncc3)=N2)c1 |
| InChI | InChI=1S/C21H14N4S/c1-2-5-16-14(4-1)7-8-17-19(16)24-21(18-6-3-13-26-18)25-20(23-17)15-9-11-22-12-10-15/h1-13H,(H,23,24,25) |
| InChIKey | MVCCBDLIJSPOBF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |