C14H20N6O2S — CID 23607692
N,N-dimethyl-4-(1-phenyltetrazol-5-yl)piperidine-1-sulfonamide (PubChem CID 23607692) has the molecular formula C14H20N6O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is N,N-dimethyl-4-(1-phenyltetrazol-5-yl)piperidine-1-sulfonamide.
| Compound Name | N,N-dimethyl-4-(1-phenyltetrazol-5-yl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 23607692 |
| Molecular Formula | C14H20N6O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N,N-dimethyl-4-(1-phenyltetrazol-5-yl)piperidine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCC(c2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C14H20N6O2S/c1-18(2)23(21,22)19-10-8-12(9-11-19)14-15-16-17-20(14)13-6-4-3-5-7-13/h3-7,12H,8-11H2,1-2H3 |
| InChIKey | GYJALTGBHIYJCO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |