C18H11F2NO4S2 — CID 2361389
3-[(5E)-5-[[4-(difluoromethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid (PubChem CID 2361389) has the molecular formula C18H11F2NO4S2 and a molecular weight of 407.42 g/mol. Its IUPAC name is 3-[(5E)-5-[[4-(difluoromethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid.
| Compound Name | 3-[(5E)-5-[[4-(difluoromethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 2361389 |
| Molecular Formula | C18H11F2NO4S2 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | 3-[(5E)-5-[[4-(difluoromethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(N2C(=O)/C(=C\c3ccc(OC(F)F)cc3)SC2=S)c1 |
| InChI | InChI=1S/C18H11F2NO4S2/c19-17(20)25-13-6-4-10(5-7-13)8-14-15(22)21(18(26)27-14)12-3-1-2-11(9-12)16(23)24/h1-9,17H,(H,23,24)/b14-8+ |
| InChIKey | GOJZZQWNKAFDFU-RIYZIHGNSA-N |
| XLogP | 4.39 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|