C16H11F2N2O2S2+ — CID 4693108
5-[[4-(difluoromethoxy)phenyl]methylidene]-3-pyridin-1-ium-3-yl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4693108) has the molecular formula C16H11F2N2O2S2+ and a molecular weight of 365.41 g/mol. Its IUPAC name is 5-[[4-(difluoromethoxy)phenyl]methylidene]-3-pyridin-1-ium-3-yl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-(difluoromethoxy)phenyl]methylidene]-3-pyridin-1-ium-3-yl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4693108 |
| Molecular Formula | C16H11F2N2O2S2+ |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 5-[[4-(difluoromethoxy)phenyl]methylidene]-3-pyridin-1-ium-3-yl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2ccc(OC(F)F)cc2)SC(=S)N1c1ccc[nH+]c1 |
| InChI | InChI=1S/C16H10F2N2O2S2/c17-15(18)22-12-5-3-10(4-6-12)8-13-14(21)20(16(23)24-13)11-2-1-7-19-9-11/h1-9,15H/p+1 |
| InChIKey | JVRHUACPBBKQGJ-UHFFFAOYSA-O |
| XLogP | 3.51 |
| TPSA | 43.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|