C19H12F4N2O3S2 — CID 4557056
5-[[4-(difluoromethoxy)phenyl]methylidene]-3-[[4-(difluoromethoxy)phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4557056) has the molecular formula C19H12F4N2O3S2 and a molecular weight of 456.44 g/mol. Its IUPAC name is 5-[[4-(difluoromethoxy)phenyl]methylidene]-3-[[4-(difluoromethoxy)phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-(difluoromethoxy)phenyl]methylidene]-3-[[4-(difluoromethoxy)phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4557056 |
| Molecular Formula | C19H12F4N2O3S2 |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 5-[[4-(difluoromethoxy)phenyl]methylidene]-3-[[4-(difluoromethoxy)phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2ccc(OC(F)F)cc2)SC(=S)N1N=Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H12F4N2O3S2/c20-17(21)27-13-5-1-11(2-6-13)9-15-16(26)25(19(29)30-15)24-10-12-3-7-14(8-4-12)28-18(22)23/h1-10,17-18H |
| InChIKey | KEAQVURFFPNHFJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|