C17H30IN2O3- — CID 23623399
N,N-dimethylcarbamate;[2-hydroxy-5-(2-methylbutan-2-yl)phenyl]-trimethylazanium;iodide (PubChem CID 23623399) has the molecular formula C17H30IN2O3- and a molecular weight of 437.34 g/mol. Its IUPAC name is N,N-dimethylcarbamate;[2-hydroxy-5-(2-methylbutan-2-yl)phenyl]-trimethylazanium;iodide.
| Compound Name | N,N-dimethylcarbamate;[2-hydroxy-5-(2-methylbutan-2-yl)phenyl]-trimethylazanium;iodide |
|---|---|
| PubChem CID | 23623399 |
| Molecular Formula | C17H30IN2O3- |
| Molecular Weight | 437.34 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | N,N-dimethylcarbamate;[2-hydroxy-5-(2-methylbutan-2-yl)phenyl]-trimethylazanium;iodide |
| SMILES | CCC(C)(C)c1ccc(O)c([N+](C)(C)C)c1.CN(C)C(=O)[O-].[I-] |
| InChI | InChI=1S/C14H23NO.C3H7NO2.HI/c1-7-14(2,3)11-8-9-13(16)12(10-11)15(4,5)6;1-4(2)3(5)6;/h8-10H,7H2,1-6H3;1-2H3,(H,5,6);1H/p-1 |
| InChIKey | KEDHZOLXJDLEEL-UHFFFAOYSA-M |
| XLogP | -0.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.34 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|