C21H38BrN2O3- — CID 23622316
N,N-dimethylcarbamate;[2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]methyl-trimethylazanium;bromide (PubChem CID 23622316) has the molecular formula C21H38BrN2O3- and a molecular weight of 446.45 g/mol. Its IUPAC name is N,N-dimethylcarbamate;[2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]methyl-trimethylazanium;bromide.
| Compound Name | N,N-dimethylcarbamate;[2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]methyl-trimethylazanium;bromide |
|---|---|
| PubChem CID | 23622316 |
| Molecular Formula | C21H38BrN2O3- |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N,N-dimethylcarbamate;[2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]methyl-trimethylazanium;bromide |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(O)c(C[N+](C)(C)C)c1.CN(C)C(=O)[O-].[Br-] |
| InChI | InChI=1S/C18H31NO.C3H7NO2.BrH/c1-17(2,3)13-18(4,5)15-9-10-16(20)14(11-15)12-19(6,7)8;1-4(2)3(5)6;/h9-11H,12-13H2,1-8H3;1-2H3,(H,5,6);1H/p-1 |
| InChIKey | UDMRMURWAGWHRI-UHFFFAOYSA-M |
| XLogP | 0.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|