C20H30IN2O2+ — CID 11503471
[2-hydroxy-5-[4-hydroxy-3-[(trimethylazaniumyl)methyl]phenyl]phenyl]methyl-trimethylazanium iodide (PubChem CID 11503471) has the molecular formula C20H30IN2O2+ and a molecular weight of 457.38 g/mol. Its IUPAC name is [2-hydroxy-5-[4-hydroxy-3-[(trimethylazaniumyl)methyl]phenyl]phenyl]methyl-trimethylazanium iodide.
| Compound Name | [2-hydroxy-5-[4-hydroxy-3-[(trimethylazaniumyl)methyl]phenyl]phenyl]methyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 11503471 |
| Molecular Formula | C20H30IN2O2+ |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | [2-hydroxy-5-[4-hydroxy-3-[(trimethylazaniumyl)methyl]phenyl]phenyl]methyl-trimethylazanium iodide |
| SMILES | C[N+](C)(C)Cc1cc(-c2ccc(O)c(C[N+](C)(C)C)c2)ccc1O.[I-] |
| InChI | InChI=1S/C20H28N2O2.HI/c1-21(2,3)13-17-11-15(7-9-19(17)23)16-8-10-20(24)18(12-16)14-22(4,5)6;/h7-12H,13-14H2,1-6H3;1H/p+1 |
| InChIKey | UPSORWVEIGNHJY-UHFFFAOYSA-O |
| XLogP | 0.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|