C28H28NO4S+ — CID 102195719
[5-[4-[4-(benzenesulfonyl)phenoxy]phenyl]-2-hydroxyphenyl]methyl-trimethylazanium (PubChem CID 102195719) has the molecular formula C28H28NO4S+ and a molecular weight of 474.60 g/mol. Its IUPAC name is [5-[4-[4-(benzenesulfonyl)phenoxy]phenyl]-2-hydroxyphenyl]methyl-trimethylazanium.
| Compound Name | [5-[4-[4-(benzenesulfonyl)phenoxy]phenyl]-2-hydroxyphenyl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 102195719 |
| Molecular Formula | C28H28NO4S+ |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | [5-[4-[4-(benzenesulfonyl)phenoxy]phenyl]-2-hydroxyphenyl]methyl-trimethylazanium |
| SMILES | C[N+](C)(C)Cc1cc(-c2ccc(Oc3ccc(S(=O)(=O)c4ccccc4)cc3)cc2)ccc1O |
| InChI | InChI=1S/C28H27NO4S/c1-29(2,3)20-23-19-22(11-18-28(23)30)21-9-12-24(13-10-21)33-25-14-16-27(17-15-25)34(31,32)26-7-5-4-6-8-26/h4-19H,20H2,1-3H3/p+1 |
| InChIKey | NPWHKXXXCBWPNS-UHFFFAOYSA-O |
| XLogP | 5.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|