C10H16BrNO3 — CID 3083484
trimethyl-[(2,3,6-trihydroxyphenyl)methyl]azanium bromide (PubChem CID 3083484) has the molecular formula C10H16BrNO3 and a molecular weight of 278.15 g/mol. Its IUPAC name is trimethyl-[(2,3,6-trihydroxyphenyl)methyl]azanium bromide.
| Compound Name | trimethyl-[(2,3,6-trihydroxyphenyl)methyl]azanium bromide |
|---|---|
| PubChem CID | 3083484 |
| Molecular Formula | C10H16BrNO3 |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | trimethyl-[(2,3,6-trihydroxyphenyl)methyl]azanium bromide |
| SMILES | C[N+](C)(C)Cc1c(O)ccc(O)c1O.[Br-] |
| InChI | InChI=1S/C10H15NO3.BrH/c1-11(2,3)6-7-8(12)4-5-9(13)10(7)14;/h4-5H,6H2,1-3H3,(H2-,12,13,14);1H |
| InChIKey | UKPGQPPNPZUPQM-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|