C46H47N7O — CID 23624844
7-amino-5-cyclohexyl-3,8-dimethyl-1-[4-[2-(1-tritylimidazol-2-yl)ethylamino]phenyl]-1,3,4-benzotriazepin-2-one (PubChem CID 23624844) has the molecular formula C46H47N7O and a molecular weight of 713.93 g/mol. Its IUPAC name is 7-amino-5-cyclohexyl-3,8-dimethyl-1-[4-[2-(1-tritylimidazol-2-yl)ethylamino]phenyl]-1,3,4-benzotriazepin-2-one.
| Compound Name | 7-amino-5-cyclohexyl-3,8-dimethyl-1-[4-[2-(1-tritylimidazol-2-yl)ethylamino]phenyl]-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 23624844 |
| Molecular Formula | C46H47N7O |
| Molecular Weight | 713.93 g/mol |
| Exact Mass | 713.38 |
| IUPAC Name | 7-amino-5-cyclohexyl-3,8-dimethyl-1-[4-[2-(1-tritylimidazol-2-yl)ethylamino]phenyl]-1,3,4-benzotriazepin-2-one |
| SMILES | Cc1cc2c(cc1N)C(C1CCCCC1)=NN(C)C(=O)N2c1ccc(NCCc2nccn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C46H47N7O/c1-33-31-42-40(32-41(33)47)44(34-15-7-3-8-16-34)50-51(2)45(54)53(42)39-25-23-38(24-26-39)48-28-27-43-49-29-30-52(43)46(35-17-9-4-10-18-35,36-19-11-5-12-20-36)37-21-13-6-14-22-37/h4-6,9-14,17-26,29-32,34,48H,3,7-8,15-16,27-28,47H2,1-2H3 |
| InChIKey | WJFJEXMBGPYPFA-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.93 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|