C36H40N6O2 — CID 23626732
1-[4-[2-(1H-imidazol-2-yl)ethylamino]phenyl]-8-methyl-5-(oxan-4-yl)-3-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)-1,3,4-benzotriazepin-2-one (PubChem CID 23626732) has the molecular formula C36H40N6O2 and a molecular weight of 588.76 g/mol. Its IUPAC name is 1-[4-[2-(1H-imidazol-2-yl)ethylamino]phenyl]-8-methyl-5-(oxan-4-yl)-3-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)-1,3,4-benzotriazepin-2-one.
| Compound Name | 1-[4-[2-(1H-imidazol-2-yl)ethylamino]phenyl]-8-methyl-5-(oxan-4-yl)-3-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 23626732 |
| Molecular Formula | C36H40N6O2 |
| Molecular Weight | 588.76 g/mol |
| Exact Mass | 588.32 |
| IUPAC Name | 1-[4-[2-(1H-imidazol-2-yl)ethylamino]phenyl]-8-methyl-5-(oxan-4-yl)-3-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)-1,3,4-benzotriazepin-2-one |
| SMILES | Cc1ccc2c(c1)N(c1ccc(NCCc3ncc[nH]3)cc1)C(=O)N(C1CCc3ccccc3CC1)N=C2C1CCOCC1 |
| InChI | InChI=1S/C36H40N6O2/c1-25-6-15-32-33(24-25)41(30-13-9-29(10-14-30)37-19-16-34-38-20-21-39-34)36(43)42(40-35(32)28-17-22-44-23-18-28)31-11-7-26-4-2-3-5-27(26)8-12-31/h2-6,9-10,13-15,20-21,24,28,31,37H,7-8,11-12,16-19,22-23H2,1H3,(H,38,39) |
| InChIKey | TUPMMOMMNNUFEJ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.76 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |