C32H46N6O3 — CID 23626886
N-(4-butoxyphenyl)-4-[(3S)-3-[4-(6-methyl-2-pyridinyl)piperazine-1-carbonyl]piperidin-1-yl]piperidine-1-carboxamide (PubChem CID 23626886) has the molecular formula C32H46N6O3 and a molecular weight of 562.76 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-4-[(3S)-3-[4-(6-methyl-2-pyridinyl)piperazine-1-carbonyl]piperidin-1-yl]piperidine-1-carboxamide.
| Compound Name | N-(4-butoxyphenyl)-4-[(3S)-3-[4-(6-methyl-2-pyridinyl)piperazine-1-carbonyl]piperidin-1-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 23626886 |
| Molecular Formula | C32H46N6O3 |
| Molecular Weight | 562.76 g/mol |
| Exact Mass | 562.36 |
| IUPAC Name | N-(4-butoxyphenyl)-4-[(3S)-3-[4-(6-methyl-2-pyridinyl)piperazine-1-carbonyl]piperidin-1-yl]piperidine-1-carboxamide |
| SMILES | CCCCOc1ccc(NC(=O)N2CCC(N3CCC[C@H](C(=O)N4CCN(c5cccc(C)n5)CC4)C3)CC2)cc1 |
| InChI | InChI=1S/C32H46N6O3/c1-3-4-23-41-29-12-10-27(11-13-29)34-32(40)37-17-14-28(15-18-37)38-16-6-8-26(24-38)31(39)36-21-19-35(20-22-36)30-9-5-7-25(2)33-30/h5,7,9-13,26,28H,3-4,6,8,14-24H2,1-2H3,(H,34,40)/t26-/m0/s1 |
| InChIKey | TUGVNLPVMXMGEN-SANMLTNESA-N |
| XLogP | 4.63 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.76 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|