C8H13N3O2 — CID 23629746
N,N-diethyl-2-oxo-1,3-dihydroimidazole-4-carboxamide (PubChem CID 23629746) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is N,N-diethyl-2-oxo-1,3-dihydroimidazole-4-carboxamide.
| Compound Name | N,N-diethyl-2-oxo-1,3-dihydroimidazole-4-carboxamide |
|---|---|
| PubChem CID | 23629746 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | N,N-diethyl-2-oxo-1,3-dihydroimidazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C8H13N3O2/c1-3-11(4-2)7(12)6-5-9-8(13)10-6/h5H,3-4H2,1-2H3,(H2,9,10,13) |
| InChIKey | SUGJGCLPKHYTFU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |