C39H62O10SSi — CID 23631299
methyl (3S,8R,9S,11R)-7-acetyloxy-6-(benzenesulfonyl)-12-[tert-butyl(dimethyl)silyl]oxy-9-(methoxymethoxy)-3,7,11-trimethyl-8-phenylmethoxydodecanoate (PubChem CID 23631299) has the molecular formula C39H62O10SSi and a molecular weight of 751.07 g/mol. Its IUPAC name is methyl (3S,8R,9S,11R)-7-acetyloxy-6-(benzenesulfonyl)-12-[tert-butyl(dimethyl)silyl]oxy-9-(methoxymethoxy)-3,7,11-trimethyl-8-phenylmethoxydodecanoate.
| Compound Name | methyl (3S,8R,9S,11R)-7-acetyloxy-6-(benzenesulfonyl)-12-[tert-butyl(dimethyl)silyl]oxy-9-(methoxymethoxy)-3,7,11-trimethyl-8-phenylmethoxydodecanoate |
|---|---|
| PubChem CID | 23631299 |
| Molecular Formula | C39H62O10SSi |
| Molecular Weight | 751.07 g/mol |
| Exact Mass | 750.38 |
| IUPAC Name | methyl (3S,8R,9S,11R)-7-acetyloxy-6-(benzenesulfonyl)-12-[tert-butyl(dimethyl)silyl]oxy-9-(methoxymethoxy)-3,7,11-trimethyl-8-phenylmethoxydodecanoate |
| SMILES | COCO[C@@H](C[C@@H](C)CO[Si](C)(C)C(C)(C)C)[C@@H](OCc1ccccc1)C(C)(OC(C)=O)C(CC[C@H](C)CC(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C39H62O10SSi/c1-29(25-36(41)45-9)22-23-35(50(42,43)33-20-16-13-17-21-33)39(7,49-31(3)40)37(46-27-32-18-14-12-15-19-32)34(47-28-44-8)24-30(2)26-48-51(10,11)38(4,5)6/h12-21,29-30,34-35,37H,22-28H2,1-11H3/t29-,30+,34-,35?,37+,39?/m0/s1 |
| InChIKey | SKTGHCNNOJTITI-JLOZWOFPSA-N |
| XLogP | 7.75 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.07 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|