C43H74O8SSi2 — CID 134877868
tert-butyl (4R,5R,6S,7S,10S)-8-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-5,7-dimethyl-11-phenylmethoxy-4-triethylsilyloxyundecanoate (PubChem CID 134877868) has the molecular formula C43H74O8SSi2 and a molecular weight of 807.30 g/mol. Its IUPAC name is tert-butyl (4R,5R,6S,7S,10S)-8-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-5,7-dimethyl-11-phenylmethoxy-4-triethylsilyloxyundecanoate.
| Compound Name | tert-butyl (4R,5R,6S,7S,10S)-8-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-5,7-dimethyl-11-phenylmethoxy-4-triethylsilyloxyundecanoate |
|---|---|
| PubChem CID | 134877868 |
| Molecular Formula | C43H74O8SSi2 |
| Molecular Weight | 807.30 g/mol |
| Exact Mass | 806.46 |
| IUPAC Name | tert-butyl (4R,5R,6S,7S,10S)-8-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-5,7-dimethyl-11-phenylmethoxy-4-triethylsilyloxyundecanoate |
| SMILES | CC[Si](CC)(CC)O[C@H](CCC(=O)OC(C)(C)C)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(C[C@@H](COCc1ccccc1)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C43H74O8SSi2/c1-15-54(16-2,17-3)50-38(28-29-40(44)49-42(6,7)8)33(4)41(51-53(13,14)43(9,10)11)34(5)39(52(45,46)37-26-22-19-23-27-37)30-36(47-12)32-48-31-35-24-20-18-21-25-35/h18-27,33-34,36,38-39,41H,15-17,28-32H2,1-14H3/t33-,34-,36+,38-,39?,41+/m1/s1 |
| InChIKey | HBEIESPUYMJSKM-ZWFDVOCZSA-N |
| XLogP | 10.63 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.30 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|