C32H42O6S — CID 139263613
methyl (2S)-3-[(1R,3R,3aR,4R,7aR)-3-[(1R)-1-(benzenesulfonyl)ethyl]-7-methyl-4-propan-2-yl-1,3,3a,4,5,7a-hexahydro-2-benzofuran-1-yl]-2-methyl-2-phenylmethoxypropanoate (PubChem CID 139263613) has the molecular formula C32H42O6S and a molecular weight of 554.75 g/mol. Its IUPAC name is methyl (2S)-3-[(1R,3R,3aR,4R,7aR)-3-[(1R)-1-(benzenesulfonyl)ethyl]-7-methyl-4-propan-2-yl-1,3,3a,4,5,7a-hexahydro-2-benzofuran-1-yl]-2-methyl-2-phenylmethoxypropanoate.
| Compound Name | methyl (2S)-3-[(1R,3R,3aR,4R,7aR)-3-[(1R)-1-(benzenesulfonyl)ethyl]-7-methyl-4-propan-2-yl-1,3,3a,4,5,7a-hexahydro-2-benzofuran-1-yl]-2-methyl-2-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 139263613 |
| Molecular Formula | C32H42O6S |
| Molecular Weight | 554.75 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | methyl (2S)-3-[(1R,3R,3aR,4R,7aR)-3-[(1R)-1-(benzenesulfonyl)ethyl]-7-methyl-4-propan-2-yl-1,3,3a,4,5,7a-hexahydro-2-benzofuran-1-yl]-2-methyl-2-phenylmethoxypropanoate |
| SMILES | COC(=O)[C@](C)(C[C@H]1O[C@@H]([C@@H](C)S(=O)(=O)c2ccccc2)[C@H]2[C@@H]1C(C)=CC[C@@H]2C(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C32H42O6S/c1-21(2)26-18-17-22(3)28-27(19-32(5,31(33)36-6)37-20-24-13-9-7-10-14-24)38-30(29(26)28)23(4)39(34,35)25-15-11-8-12-16-25/h7-17,21,23,26-30H,18-20H2,1-6H3/t23-,26-,27-,28-,29-,30+,32+/m1/s1 |
| InChIKey | BQFWNGKQIJTURC-PSTXVEFSSA-N |
| XLogP | 6.01 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.75 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|