C24H26O9S — CID 134934875
[(2S)-2-acetyloxy-2-[(2S,3S)-3-[(S)-acetyloxy(phenyl)methyl]-3-(benzenesulfonyl)-2-methyloxiran-2-yl]ethyl] acetate (PubChem CID 134934875) has the molecular formula C24H26O9S and a molecular weight of 490.53 g/mol. Its IUPAC name is [(2S)-2-acetyloxy-2-[(2S,3S)-3-[(S)-acetyloxy(phenyl)methyl]-3-(benzenesulfonyl)-2-methyloxiran-2-yl]ethyl] acetate.
| Compound Name | [(2S)-2-acetyloxy-2-[(2S,3S)-3-[(S)-acetyloxy(phenyl)methyl]-3-(benzenesulfonyl)-2-methyloxiran-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 134934875 |
| Molecular Formula | C24H26O9S |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | [(2S)-2-acetyloxy-2-[(2S,3S)-3-[(S)-acetyloxy(phenyl)methyl]-3-(benzenesulfonyl)-2-methyloxiran-2-yl]ethyl] acetate |
| SMILES | CC(=O)OC[C@H](OC(C)=O)[C@]1(C)O[C@@]1([C@@H](OC(C)=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H26O9S/c1-16(25)30-15-21(31-17(2)26)23(4)24(33-23,34(28,29)20-13-9-6-10-14-20)22(32-18(3)27)19-11-7-5-8-12-19/h5-14,21-22H,15H2,1-4H3/t21-,22-,23-,24-/m0/s1 |
| InChIKey | ZEYVOHLYXUVLPK-ZJZGAYNASA-N |
| XLogP | 2.74 |
| TPSA | 125.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|