C17H18O4S — CID 10969181
(2R,3R)-2-(4-methylphenyl)sulfonyl-3-(phenylmethoxymethyl)oxirane (PubChem CID 10969181) has the molecular formula C17H18O4S and a molecular weight of 318.39 g/mol. Its IUPAC name is (2R,3R)-2-(4-methylphenyl)sulfonyl-3-(phenylmethoxymethyl)oxirane.
| Compound Name | (2R,3R)-2-(4-methylphenyl)sulfonyl-3-(phenylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 10969181 |
| Molecular Formula | C17H18O4S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (2R,3R)-2-(4-methylphenyl)sulfonyl-3-(phenylmethoxymethyl)oxirane |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2O[C@@H]2COCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H18O4S/c1-13-7-9-15(10-8-13)22(18,19)17-16(21-17)12-20-11-14-5-3-2-4-6-14/h2-10,16-17H,11-12H2,1H3/t16-,17-/m1/s1 |
| InChIKey | FTQGJRNNIOSEMA-IAGOWNOFSA-N |
| XLogP | 2.71 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|