C33H48O6SSi — CID 134981804
[(4R)-3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]-4-methylpentan-2-yl] benzoate (PubChem CID 134981804) has the molecular formula C33H48O6SSi and a molecular weight of 600.89 g/mol. Its IUPAC name is [(4R)-3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]-4-methylpentan-2-yl] benzoate.
| Compound Name | [(4R)-3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]-4-methylpentan-2-yl] benzoate |
|---|---|
| PubChem CID | 134981804 |
| Molecular Formula | C33H48O6SSi |
| Molecular Weight | 600.89 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | [(4R)-3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]-4-methylpentan-2-yl] benzoate |
| SMILES | CC[C@H]1O[C@@H](C(C)(OC(=O)c2ccccc2)C([C@H](C)CO[Si](C)(C)C(C)(C)C)S(=O)(=O)c2ccccc2)CC=C1C |
| InChI | InChI=1S/C33H48O6SSi/c1-10-28-24(2)21-22-29(38-28)33(7,39-31(34)26-17-13-11-14-18-26)30(40(35,36)27-19-15-12-16-20-27)25(3)23-37-41(8,9)32(4,5)6/h11-21,25,28-30H,10,22-23H2,1-9H3/t25-,28-,29-,30?,33?/m1/s1 |
| InChIKey | YQAHTCZNBQFZCX-SGCFCSGPSA-N |
| XLogP | 7.62 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.89 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|