C31H42O8SSi — CID 11204201
[(2R,3S,4S,5R,6S)-3-acetyloxy-5-benzoyloxy-4-[diethyl(propan-2-yl)silyl]oxy-6-ethylsulfanyloxan-2-yl]methyl benzoate (PubChem CID 11204201) has the molecular formula C31H42O8SSi and a molecular weight of 602.82 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3-acetyloxy-5-benzoyloxy-4-[diethyl(propan-2-yl)silyl]oxy-6-ethylsulfanyloxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3-acetyloxy-5-benzoyloxy-4-[diethyl(propan-2-yl)silyl]oxy-6-ethylsulfanyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11204201 |
| Molecular Formula | C31H42O8SSi |
| Molecular Weight | 602.82 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3-acetyloxy-5-benzoyloxy-4-[diethyl(propan-2-yl)silyl]oxy-6-ethylsulfanyloxan-2-yl]methyl benzoate |
| SMILES | CCS[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@H](OC(C)=O)[C@H](O[Si](CC)(CC)C(C)C)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H42O8SSi/c1-7-40-31-28(38-30(34)24-18-14-11-15-19-24)27(39-41(8-2,9-3)21(4)5)26(36-22(6)32)25(37-31)20-35-29(33)23-16-12-10-13-17-23/h10-19,21,25-28,31H,7-9,20H2,1-6H3/t25-,26+,27+,28-,31+/m1/s1 |
| InChIKey | JXPZSUYLJRIBBC-GJMZGWRTSA-N |
| XLogP | 6.26 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.82 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|