C20H18N4O3S2 — CID 23632060
N'-(6-methoxy-2-thiophen-2-ylquinazolin-4-yl)-4-methylbenzenesulfonohydrazide (PubChem CID 23632060) has the molecular formula C20H18N4O3S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is N'-(6-methoxy-2-thiophen-2-ylquinazolin-4-yl)-4-methylbenzenesulfonohydrazide.
| Compound Name | N'-(6-methoxy-2-thiophen-2-ylquinazolin-4-yl)-4-methylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 23632060 |
| Molecular Formula | C20H18N4O3S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | N'-(6-methoxy-2-thiophen-2-ylquinazolin-4-yl)-4-methylbenzenesulfonohydrazide |
| SMILES | COc1ccc2nc(-c3cccs3)nc(NNS(=O)(=O)c3ccc(C)cc3)c2c1 |
| InChI | InChI=1S/C20H18N4O3S2/c1-13-5-8-15(9-6-13)29(25,26)24-23-19-16-12-14(27-2)7-10-17(16)21-20(22-19)18-4-3-11-28-18/h3-12,24H,1-2H3,(H,21,22,23) |
| InChIKey | FNWNYVAZPFXFRY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|