C10H18N2S — CID 2363379
N-cyclohexyl-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 2363379) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is N-cyclohexyl-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | N-cyclohexyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 2363379 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | N-cyclohexyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | C1CCC(NC2=NCCCS2)CC1 |
| InChI | InChI=1S/C10H18N2S/c1-2-5-9(6-3-1)12-10-11-7-4-8-13-10/h9H,1-8H2,(H,11,12) |
| InChIKey | QOUZDUIPGBMLCY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |