C9H16N2S — CID 568661
N-cyclohexyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 568661) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is N-cyclohexyl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-cyclohexyl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 568661 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | N-cyclohexyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | C1CCC(NC2=NCCS2)CC1 |
| InChI | InChI=1S/C9H16N2S/c1-2-4-8(5-3-1)11-9-10-6-7-12-9/h8H,1-7H2,(H,10,11) |
| InChIKey | SGMNKDCGMQDDCB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |